C47H28N4OS2 — CID 141186216
5-[2-(1-benzofuran-2-yl)-1H-indol-3-yl]-1,3-bis(1-benzothiophen-2-yl)-4-(2H-isoindol-1-yl)indazole (PubChem CID 141186216) has the molecular formula C47H28N4OS2 and a molecular weight of 728.90 g/mol. Its IUPAC name is 5-[2-(1-benzofuran-2-yl)-1H-indol-3-yl]-1,3-bis(1-benzothiophen-2-yl)-4-(2H-isoindol-1-yl)indazole.
| Compound Name | 5-[2-(1-benzofuran-2-yl)-1H-indol-3-yl]-1,3-bis(1-benzothiophen-2-yl)-4-(2H-isoindol-1-yl)indazole |
|---|---|
| PubChem CID | 141186216 |
| Molecular Formula | C47H28N4OS2 |
| Molecular Weight | 728.90 g/mol |
| Exact Mass | 728.17 |
| IUPAC Name | 5-[2-(1-benzofuran-2-yl)-1H-indol-3-yl]-1,3-bis(1-benzothiophen-2-yl)-4-(2H-isoindol-1-yl)indazole |
| SMILES | c1ccc2oc(-c3[nH]c4ccccc4c3-c3ccc4c(c(-c5cc6ccccc6s5)nn4-c4cc5ccccc5s4)c3-c3[nH]cc4ccccc34)cc2c1 |
| InChI | InChI=1S/C47H28N4OS2/c1-5-15-31-30(14-1)26-48-45(31)43-33(42-32-16-6-7-17-34(32)49-46(42)37-23-27-11-2-8-18-36(27)52-37)21-22-35-44(43)47(40-24-28-12-3-9-19-38(28)53-40)50-51(35)41-25-29-13-4-10-20-39(29)54-41/h1-26,48-49H |
| InChIKey | RKUJIVKSZHMSJW-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.90 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |