C17H26O4 — CID 141186903
dipropan-2-yl 1,4-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 141186903) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is dipropan-2-yl 1,4-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | dipropan-2-yl 1,4-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 141186903 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | dipropan-2-yl 1,4-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CC(C)OC(=O)C1C(C(=O)OC(C)C)C2(C)C=CC1(C)C2 |
| InChI | InChI=1S/C17H26O4/c1-10(2)20-14(18)12-13(15(19)21-11(3)4)17(6)8-7-16(12,5)9-17/h7-8,10-13H,9H2,1-6H3 |
| InChIKey | XTHVRSANARCXTG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|