C16H16FNO3 — CID 141189675
4-[(2-fluoro-4-hydroxy-N-methylanilino)methyl]-2-methylbenzoic acid (PubChem CID 141189675) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is 4-[(2-fluoro-4-hydroxy-N-methylanilino)methyl]-2-methylbenzoic acid.
| Compound Name | 4-[(2-fluoro-4-hydroxy-N-methylanilino)methyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 141189675 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-[(2-fluoro-4-hydroxy-N-methylanilino)methyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(CN(C)c2ccc(O)cc2F)ccc1C(=O)O |
| InChI | InChI=1S/C16H16FNO3/c1-10-7-11(3-5-13(10)16(20)21)9-18(2)15-6-4-12(19)8-14(15)17/h3-8,19H,9H2,1-2H3,(H,20,21) |
| InChIKey | MQFOCEHWOBGGHQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |