C5H9NO2S — CID 141190228
3-(hydroxymethyl)-4-methyl-1,3-thiazolidin-2-one (PubChem CID 141190228) has the molecular formula C5H9NO2S and a molecular weight of 147.20 g/mol. Its IUPAC name is 3-(hydroxymethyl)-4-methyl-1,3-thiazolidin-2-one.
| Compound Name | 3-(hydroxymethyl)-4-methyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 141190228 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 3-(hydroxymethyl)-4-methyl-1,3-thiazolidin-2-one |
| SMILES | CC1CSC(=O)N1CO |
| InChI | InChI=1S/C5H9NO2S/c1-4-2-9-5(8)6(4)3-7/h4,7H,2-3H2,1H3 |
| InChIKey | HBXPEWNCWDNSRN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|