C13H21NO3S — CID 141190740
2-[4-[2-(oxan-2-yloxy)ethyl]-1,3-thiazol-5-yl]propan-2-ol (PubChem CID 141190740) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is 2-[4-[2-(oxan-2-yloxy)ethyl]-1,3-thiazol-5-yl]propan-2-ol.
| Compound Name | 2-[4-[2-(oxan-2-yloxy)ethyl]-1,3-thiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 141190740 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[4-[2-(oxan-2-yloxy)ethyl]-1,3-thiazol-5-yl]propan-2-ol |
| SMILES | CC(C)(O)c1scnc1CCOC1CCCCO1 |
| InChI | InChI=1S/C13H21NO3S/c1-13(2,15)12-10(14-9-18-12)6-8-17-11-5-3-4-7-16-11/h9,11,15H,3-8H2,1-2H3 |
| InChIKey | PLEDPFBKEJSRFK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |