C37H62O6Si2 — CID 160574472
ditert-butyl-hydroxy-[4-[2-(oxan-2-yloxy)ethyl]phenyl]silane;2-[4-[ditert-butyl(hydroxy)silyl]phenyl]acetic acid (PubChem CID 160574472) has the molecular formula C37H62O6Si2 and a molecular weight of 659.07 g/mol. Its IUPAC name is ditert-butyl-hydroxy-[4-[2-(oxan-2-yloxy)ethyl]phenyl]silane;2-[4-[ditert-butyl(hydroxy)silyl]phenyl]acetic acid.
| Compound Name | ditert-butyl-hydroxy-[4-[2-(oxan-2-yloxy)ethyl]phenyl]silane;2-[4-[ditert-butyl(hydroxy)silyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 160574472 |
| Molecular Formula | C37H62O6Si2 |
| Molecular Weight | 659.07 g/mol |
| Exact Mass | 658.41 |
| IUPAC Name | ditert-butyl-hydroxy-[4-[2-(oxan-2-yloxy)ethyl]phenyl]silane;2-[4-[ditert-butyl(hydroxy)silyl]phenyl]acetic acid |
| SMILES | CC(C)(C)[Si](O)(c1ccc(CC(=O)O)cc1)C(C)(C)C.CC(C)(C)[Si](O)(c1ccc(CCOC2CCCCO2)cc1)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si.C16H26O3Si/c1-20(2,3)25(22,21(4,5)6)18-12-10-17(11-13-18)14-16-24-19-9-7-8-15-23-19;1-15(2,3)20(19,16(4,5)6)13-9-7-12(8-10-13)11-14(17)18/h10-13,19,22H,7-9,14-16H2,1-6H3;7-10,19H,11H2,1-6H3,(H,17,18) |
| InChIKey | RAYUYVJAWQERLN-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.07 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|