C26H25N3O2 — CID 141191983
2-N-benzyl-2-N-(3,4-dimethoxyphenyl)-4-pyridin-4-ylbenzene-1,2-diamine (PubChem CID 141191983) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-N-benzyl-2-N-(3,4-dimethoxyphenyl)-4-pyridin-4-ylbenzene-1,2-diamine.
| Compound Name | 2-N-benzyl-2-N-(3,4-dimethoxyphenyl)-4-pyridin-4-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 141191983 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 2-N-benzyl-2-N-(3,4-dimethoxyphenyl)-4-pyridin-4-ylbenzene-1,2-diamine |
| SMILES | COc1ccc(N(Cc2ccccc2)c2cc(-c3ccncc3)ccc2N)cc1OC |
| InChI | InChI=1S/C26H25N3O2/c1-30-25-11-9-22(17-26(25)31-2)29(18-19-6-4-3-5-7-19)24-16-21(8-10-23(24)27)20-12-14-28-15-13-20/h3-17H,18,27H2,1-2H3 |
| InChIKey | QLEOQLUPXZVJIY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|