C15H19N7S — CID 141192306
2-(3-methyl-9-pentyl-5,6-dihydro-[1,2,4]triazolo[4,3-a]purin-7-yl)-1,3-thiazole (PubChem CID 141192306) has the molecular formula C15H19N7S and a molecular weight of 329.43 g/mol. Its IUPAC name is 2-(3-methyl-9-pentyl-5,6-dihydro-[1,2,4]triazolo[4,3-a]purin-7-yl)-1,3-thiazole.
| Compound Name | 2-(3-methyl-9-pentyl-5,6-dihydro-[1,2,4]triazolo[4,3-a]purin-7-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 141192306 |
| Molecular Formula | C15H19N7S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-(3-methyl-9-pentyl-5,6-dihydro-[1,2,4]triazolo[4,3-a]purin-7-yl)-1,3-thiazole |
| SMILES | CCCCCN1c2nc(-c3nccs3)[nH]c2Cn2c(C)nnc21 |
| InChI | InChI=1S/C15H19N7S/c1-3-4-5-7-21-13-11(9-22-10(2)19-20-15(21)22)17-12(18-13)14-16-6-8-23-14/h6,8H,3-5,7,9H2,1-2H3,(H,17,18) |
| InChIKey | GVYQEBHMMZTIJP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|