C44H24N6O3S — CID 141193422
4-[4-(1,2-benzothiazol-3-yl)-5-(1,3-benzoxazol-2-yl)-3-(1H-indazol-3-yl)-2-quinolin-2-ylphenyl]isoindole-1,3-dione (PubChem CID 141193422) has the molecular formula C44H24N6O3S and a molecular weight of 716.78 g/mol. Its IUPAC name is 4-[4-(1,2-benzothiazol-3-yl)-5-(1,3-benzoxazol-2-yl)-3-(1H-indazol-3-yl)-2-quinolin-2-ylphenyl]isoindole-1,3-dione.
| Compound Name | 4-[4-(1,2-benzothiazol-3-yl)-5-(1,3-benzoxazol-2-yl)-3-(1H-indazol-3-yl)-2-quinolin-2-ylphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141193422 |
| Molecular Formula | C44H24N6O3S |
| Molecular Weight | 716.78 g/mol |
| Exact Mass | 716.16 |
| IUPAC Name | 4-[4-(1,2-benzothiazol-3-yl)-5-(1,3-benzoxazol-2-yl)-3-(1H-indazol-3-yl)-2-quinolin-2-ylphenyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1cccc2-c1cc(-c2nc3ccccc3o2)c(-c2nsc3ccccc23)c(-c2n[nH]c3ccccc23)c1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C44H24N6O3S/c51-42-27-14-9-13-24(36(27)43(52)47-42)28-22-29(44-46-32-17-6-7-18-34(32)53-44)38(41-26-12-3-8-19-35(26)54-50-41)39(40-25-11-2-5-16-31(25)48-49-40)37(28)33-21-20-23-10-1-4-15-30(23)45-33/h1-22H,(H,48,49)(H,47,51,52) |
| InChIKey | KZADWBABIPMHRF-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.78 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|