C48H28N4OS5 — CID 141387526
2-(1-benzofuran-2-yl)-6-(dithiin-3-yl)-3-(1H-indazol-3-yl)-4-(1H-indol-2-yl)-5,7,8-trithiophen-2-ylquinoline (PubChem CID 141387526) has the molecular formula C48H28N4OS5 and a molecular weight of 837.11 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-6-(dithiin-3-yl)-3-(1H-indazol-3-yl)-4-(1H-indol-2-yl)-5,7,8-trithiophen-2-ylquinoline.
| Compound Name | 2-(1-benzofuran-2-yl)-6-(dithiin-3-yl)-3-(1H-indazol-3-yl)-4-(1H-indol-2-yl)-5,7,8-trithiophen-2-ylquinoline |
|---|---|
| PubChem CID | 141387526 |
| Molecular Formula | C48H28N4OS5 |
| Molecular Weight | 837.11 g/mol |
| Exact Mass | 836.09 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-6-(dithiin-3-yl)-3-(1H-indazol-3-yl)-4-(1H-indol-2-yl)-5,7,8-trithiophen-2-ylquinoline |
| SMILES | C1=CSSC(c2c(-c3cccs3)c(-c3cccs3)c3nc(-c4cc5ccccc5o4)c(-c4n[nH]c5ccccc45)c(-c4cc5ccccc5[nH]4)c3c2-c2cccs2)=C1 |
| InChI | InChI=1S/C48H28N4OS5/c1-4-14-30-27(11-1)25-32(49-30)39-44-41(36-18-8-22-55-36)42(38-20-10-24-57-58-38)40(35-17-7-21-54-35)43(37-19-9-23-56-37)48(44)50-47(34-26-28-12-2-6-16-33(28)53-34)45(39)46-29-13-3-5-15-31(29)51-52-46/h1-26,49H,(H,51,52) |
| InChIKey | JZTYIHDWLCIDST-UHFFFAOYSA-N |
| XLogP | 15.77 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.11 |
| LogP ≤ 5 | 15.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|