About N'-acetyl-N'-butylacetohydrazide
N'-acetyl-N'-butylacetohydrazide (PubChem CID 141194485) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is N'-acetyl-N'-butylacetohydrazide.
Molecular Properties
| Compound Name | N'-acetyl-N'-butylacetohydrazide |
| PubChem CID | 141194485 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | N'-acetyl-N'-butylacetohydrazide |
| SMILES | CCCCN(NC(C)=O)C(C)=O |
| InChI | InChI=1S/C8H16N2O2/c1-4-5-6-10(8(3)12)9-7(2)11/h4-6H2,1-3H3,(H,9,11) |
| InChIKey | CDMAIXBLXFRJQN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-acetyl-N'-butylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetyl-N'-butylacetohydrazide?
The IUPAC name of N'-acetyl-N'-butylacetohydrazide (CID 141194485) is N'-acetyl-N'-butylacetohydrazide.
What is the SMILES notation for N'-acetyl-N'-butylacetohydrazide?
The canonical SMILES for N'-acetyl-N'-butylacetohydrazide is CCCCN(NC(C)=O)C(C)=O.
What is the InChIKey of N'-acetyl-N'-butylacetohydrazide?
The InChIKey is CDMAIXBLXFRJQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-4-5-6-10(8(3)12)9-7(2)11/h4-6H2,1-3H3,(H,9,11).
What are the key properties of N'-acetyl-N'-butylacetohydrazide?
N'-acetyl-N'-butylacetohydrazide has a molecular weight of 172.23 g/mol, XLogP of 0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetyl-N'-butylacetohydrazide is sourced from PubChem (CID 141194485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).