About N-butyl-N-iodoacetamide
N-butyl-N-iodoacetamide (PubChem CID 18767604) has the molecular formula C6H12INO
and a molecular weight of 241.07 g/mol. Its IUPAC name is N-butyl-N-iodoacetamide.
Molecular Properties
| Compound Name | N-butyl-N-iodoacetamide |
| PubChem CID | 18767604 |
| Molecular Formula | C6H12INO |
| Molecular Weight | 241.07 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | N-butyl-N-iodoacetamide |
| SMILES | CCCCN(I)C(C)=O |
| InChI | InChI=1S/C6H12INO/c1-3-4-5-8(7)6(2)9/h3-5H2,1-2H3 |
| InChIKey | CJUYXFISIKSAGS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.07 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-iodoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-iodoacetamide?
The IUPAC name of N-butyl-N-iodoacetamide (CID 18767604) is N-butyl-N-iodoacetamide.
What is the SMILES notation for N-butyl-N-iodoacetamide?
The canonical SMILES for N-butyl-N-iodoacetamide is CCCCN(I)C(C)=O.
What is the InChIKey of N-butyl-N-iodoacetamide?
The InChIKey is CJUYXFISIKSAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12INO/c1-3-4-5-8(7)6(2)9/h3-5H2,1-2H3.
What are the key properties of N-butyl-N-iodoacetamide?
N-butyl-N-iodoacetamide has a molecular weight of 241.07 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-iodoacetamide is sourced from PubChem (CID 18767604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).