C6H9N3O — CID 141194611
N-methyl-1,2-dihydropyrazine-2-carboxamide (PubChem CID 141194611) has the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. Its IUPAC name is N-methyl-1,2-dihydropyrazine-2-carboxamide.
| Compound Name | N-methyl-1,2-dihydropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 141194611 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | N-methyl-1,2-dihydropyrazine-2-carboxamide |
| SMILES | CNC(=O)C1C=NC=CN1 |
| InChI | InChI=1S/C6H9N3O/c1-7-6(10)5-4-8-2-3-9-5/h2-5,9H,1H3,(H,7,10) |
| InChIKey | IKEHEXNWIUXESR-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |