C7H11N3O — CID 141194609
N-ethyl-1,2-dihydropyrazine-2-carboxamide (PubChem CID 141194609) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is N-ethyl-1,2-dihydropyrazine-2-carboxamide.
| Compound Name | N-ethyl-1,2-dihydropyrazine-2-carboxamide |
|---|---|
| PubChem CID | 141194609 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | N-ethyl-1,2-dihydropyrazine-2-carboxamide |
| SMILES | CCNC(=O)C1C=NC=CN1 |
| InChI | InChI=1S/C7H11N3O/c1-2-9-7(11)6-5-8-3-4-10-6/h3-6,10H,2H2,1H3,(H,9,11) |
| InChIKey | JPOMAGLHQYBNBQ-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |