C26H25ClN6 — CID 141195639
1-(3-chloro-4-piperazin-1-ylphenyl)-3-methyl-8-pyridin-3-yl-2H-imidazo[4,5-c]quinoline (PubChem CID 141195639) has the molecular formula C26H25ClN6 and a molecular weight of 456.98 g/mol. Its IUPAC name is 1-(3-chloro-4-piperazin-1-ylphenyl)-3-methyl-8-pyridin-3-yl-2H-imidazo[4,5-c]quinoline.
| Compound Name | 1-(3-chloro-4-piperazin-1-ylphenyl)-3-methyl-8-pyridin-3-yl-2H-imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 141195639 |
| Molecular Formula | C26H25ClN6 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 1-(3-chloro-4-piperazin-1-ylphenyl)-3-methyl-8-pyridin-3-yl-2H-imidazo[4,5-c]quinoline |
| SMILES | CN1CN(c2ccc(N3CCNCC3)c(Cl)c2)c2c1cnc1ccc(-c3cccnc3)cc21 |
| InChI | InChI=1S/C26H25ClN6/c1-31-17-33(20-5-7-24(22(27)14-20)32-11-9-28-10-12-32)26-21-13-18(19-3-2-8-29-15-19)4-6-23(21)30-16-25(26)31/h2-8,13-16,28H,9-12,17H2,1H3 |
| InChIKey | GRUHCDYYAHJZJX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|