C28H19NOS — CID 141196751
2-(furan-2-yl)-4-naphthalen-1-yl-5-phenyl-3-thiophen-2-yl-1H-pyrrole (PubChem CID 141196751) has the molecular formula C28H19NOS and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-(furan-2-yl)-4-naphthalen-1-yl-5-phenyl-3-thiophen-2-yl-1H-pyrrole.
| Compound Name | 2-(furan-2-yl)-4-naphthalen-1-yl-5-phenyl-3-thiophen-2-yl-1H-pyrrole |
|---|---|
| PubChem CID | 141196751 |
| Molecular Formula | C28H19NOS |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-(furan-2-yl)-4-naphthalen-1-yl-5-phenyl-3-thiophen-2-yl-1H-pyrrole |
| SMILES | c1ccc(-c2[nH]c(-c3ccco3)c(-c3cccs3)c2-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H19NOS/c1-2-10-20(11-3-1)27-25(22-14-6-12-19-9-4-5-13-21(19)22)26(24-16-8-18-31-24)28(29-27)23-15-7-17-30-23/h1-18,29H |
| InChIKey | CKONAUONTIODDR-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |