About 2-phenanthren-1-ylfuran
2-phenanthren-1-ylfuran (PubChem CID 142748745) has the molecular formula C18H12O
and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-phenanthren-1-ylfuran.
Molecular Properties
| Compound Name | 2-phenanthren-1-ylfuran |
| PubChem CID | 142748745 |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-phenanthren-1-ylfuran |
| SMILES | c1coc(-c2cccc3c2ccc2ccccc23)c1 |
| InChI | InChI=1S/C18H12O/c1-2-6-14-13(5-1)10-11-16-15(14)7-3-8-17(16)18-9-4-12-19-18/h1-12H |
| InChIKey | AEDXAQYDOGQXIK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-phenanthren-1-ylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenanthren-1-ylfuran?
The IUPAC name of 2-phenanthren-1-ylfuran (CID 142748745) is 2-phenanthren-1-ylfuran.
What is the SMILES notation for 2-phenanthren-1-ylfuran?
The canonical SMILES for 2-phenanthren-1-ylfuran is c1coc(-c2cccc3c2ccc2ccccc23)c1.
What is the InChIKey of 2-phenanthren-1-ylfuran?
The InChIKey is AEDXAQYDOGQXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O/c1-2-6-14-13(5-1)10-11-16-15(14)7-3-8-17(16)18-9-4-12-19-18/h1-12H.
What are the key properties of 2-phenanthren-1-ylfuran?
2-phenanthren-1-ylfuran has a molecular weight of 244.29 g/mol, XLogP of 5.25, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenanthren-1-ylfuran is sourced from PubChem (CID 142748745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).