C10H17NO2 — CID 141198595
(2S,3R)-3-(3-methylbut-3-enyl)pyrrolidine-2-carboxylic acid (PubChem CID 141198595) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (2S,3R)-3-(3-methylbut-3-enyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R)-3-(3-methylbut-3-enyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141198595 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (2S,3R)-3-(3-methylbut-3-enyl)pyrrolidine-2-carboxylic acid |
| SMILES | C=C(C)CC[C@@H]1CCN[C@@H]1C(=O)O |
| InChI | InChI=1S/C10H17NO2/c1-7(2)3-4-8-5-6-11-9(8)10(12)13/h8-9,11H,1,3-6H2,2H3,(H,12,13)/t8-,9+/m1/s1 |
| InChIKey | BCWUBKYLOUDKNZ-BDAKNGLRSA-N |
| XLogP | 1.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|