C6H10FNO2 — CID 155124572
(2R,3R)-3-(fluoromethyl)pyrrolidine-2-carboxylic acid (PubChem CID 155124572) has the molecular formula C6H10FNO2 and a molecular weight of 147.15 g/mol. Its IUPAC name is (2R,3R)-3-(fluoromethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,3R)-3-(fluoromethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 155124572 |
| Molecular Formula | C6H10FNO2 |
| Molecular Weight | 147.15 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (2R,3R)-3-(fluoromethyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1NCC[C@H]1CF |
| InChI | InChI=1S/C6H10FNO2/c7-3-4-1-2-8-5(4)6(9)10/h4-5,8H,1-3H2,(H,9,10)/t4-,5+/m0/s1 |
| InChIKey | RLEMIHVWCJRQNT-CRCLSJGQSA-N |
| XLogP | 0.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.15 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |