C23H33N3O — CID 141199609
[4-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]-4-phenylpiperidin-1-yl]-cyclopropylmethanone (PubChem CID 141199609) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is [4-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]-4-phenylpiperidin-1-yl]-cyclopropylmethanone.
| Compound Name | [4-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]-4-phenylpiperidin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 141199609 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | [4-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)ethyl]-4-phenylpiperidin-1-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CCC(CCN2CC3CNCC3C2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H33N3O/c27-22(18-6-7-18)26-12-9-23(10-13-26,21-4-2-1-3-5-21)8-11-25-16-19-14-24-15-20(19)17-25/h1-5,18-20,24H,6-17H2 |
| InChIKey | USPGSBIZWFUPPD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |