C11H12BrClN2O4 — CID 141200591
5-[(E)-2-bromoethenyl]-1-[(2S,4S,5R)-2-chloro-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 141200591) has the molecular formula C11H12BrClN2O4 and a molecular weight of 351.58 g/mol. Its IUPAC name is 5-[(E)-2-bromoethenyl]-1-[(2S,4S,5R)-2-chloro-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-2-bromoethenyl]-1-[(2S,4S,5R)-2-chloro-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 141200591 |
| Molecular Formula | C11H12BrClN2O4 |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 5-[(E)-2-bromoethenyl]-1-[(2S,4S,5R)-2-chloro-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@H]1O[C@@](Cl)(n2cc(/C=C/Br)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C11H12BrClN2O4/c1-6-8(16)4-11(13,19-6)15-5-7(2-3-12)9(17)14-10(15)18/h2-3,5-6,8,16H,4H2,1H3,(H,14,17,18)/b3-2+/t6-,8+,11+/m1/s1 |
| InChIKey | VDOYLRNUWMSQNP-CQQDESTRSA-N |
| XLogP | 0.92 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|