C19H30O3 — CID 141201817
2-[3-(2-hydroxyethyl)-1-adamantyl]ethyl 3-methylbut-2-enoate (PubChem CID 141201817) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethyl)-1-adamantyl]ethyl 3-methylbut-2-enoate.
| Compound Name | 2-[3-(2-hydroxyethyl)-1-adamantyl]ethyl 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 141201817 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-[3-(2-hydroxyethyl)-1-adamantyl]ethyl 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCCC12CC3CC(CC(CCO)(C3)C1)C2 |
| InChI | InChI=1S/C19H30O3/c1-14(2)7-17(21)22-6-4-19-11-15-8-16(12-19)10-18(9-15,13-19)3-5-20/h7,15-16,20H,3-6,8-13H2,1-2H3 |
| InChIKey | MORUWMPQQRZEGT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|