C12H14ClF4NO5S — CID 141202980
(5-chloro-2-fluoro-4-methoxycarbonylphenyl)-trimethylazanium;trifluoromethanesulfonate (PubChem CID 141202980) has the molecular formula C12H14ClF4NO5S and a molecular weight of 395.76 g/mol. Its IUPAC name is (5-chloro-2-fluoro-4-methoxycarbonylphenyl)-trimethylazanium;trifluoromethanesulfonate.
| Compound Name | (5-chloro-2-fluoro-4-methoxycarbonylphenyl)-trimethylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 141202980 |
| Molecular Formula | C12H14ClF4NO5S |
| Molecular Weight | 395.76 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | (5-chloro-2-fluoro-4-methoxycarbonylphenyl)-trimethylazanium;trifluoromethanesulfonate |
| SMILES | COC(=O)c1cc(F)c([N+](C)(C)C)cc1Cl.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C11H14ClFNO2.CHF3O3S/c1-14(2,3)10-6-8(12)7(5-9(10)13)11(15)16-4;2-1(3,4)8(5,6)7/h5-6H,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | QRQIJKBQLUAJQD-UHFFFAOYSA-M |
| XLogP | 2.51 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|