C23H21F4NO — CID 141203482
4-[(2,4-difluorophenyl)methoxy]-3-[(2,4-difluorophenyl)methyl]-6-methyl-1-prop-2-enyl-2H-pyridine (PubChem CID 141203482) has the molecular formula C23H21F4NO and a molecular weight of 403.42 g/mol. Its IUPAC name is 4-[(2,4-difluorophenyl)methoxy]-3-[(2,4-difluorophenyl)methyl]-6-methyl-1-prop-2-enyl-2H-pyridine.
| Compound Name | 4-[(2,4-difluorophenyl)methoxy]-3-[(2,4-difluorophenyl)methyl]-6-methyl-1-prop-2-enyl-2H-pyridine |
|---|---|
| PubChem CID | 141203482 |
| Molecular Formula | C23H21F4NO |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-[(2,4-difluorophenyl)methoxy]-3-[(2,4-difluorophenyl)methyl]-6-methyl-1-prop-2-enyl-2H-pyridine |
| SMILES | C=CCN1CC(Cc2ccc(F)cc2F)=C(OCc2ccc(F)cc2F)C=C1C |
| InChI | InChI=1S/C23H21F4NO/c1-3-8-28-13-18(10-16-4-6-19(24)11-21(16)26)23(9-15(28)2)29-14-17-5-7-20(25)12-22(17)27/h3-7,9,11-12H,1,8,10,13-14H2,2H3 |
| InChIKey | MFALVDRPKPRNNC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|