C23H28N3O5P — CID 141205137
2-[[benzyl-di(propan-2-yloxy)phosphorylamino]-(3-nitrophenyl)methyl]prop-2-enenitrile (PubChem CID 141205137) has the molecular formula C23H28N3O5P and a molecular weight of 457.47 g/mol. Its IUPAC name is 2-[[benzyl-di(propan-2-yloxy)phosphorylamino]-(3-nitrophenyl)methyl]prop-2-enenitrile.
| Compound Name | 2-[[benzyl-di(propan-2-yloxy)phosphorylamino]-(3-nitrophenyl)methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 141205137 |
| Molecular Formula | C23H28N3O5P |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-[[benzyl-di(propan-2-yloxy)phosphorylamino]-(3-nitrophenyl)methyl]prop-2-enenitrile |
| SMILES | C=C(C#N)C(c1cccc([N+](=O)[O-])c1)N(Cc1ccccc1)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C23H28N3O5P/c1-17(2)30-32(29,31-18(3)4)25(16-20-10-7-6-8-11-20)23(19(5)15-24)21-12-9-13-22(14-21)26(27)28/h6-14,17-18,23H,5,16H2,1-4H3 |
| InChIKey | IDXMIRYGLHDNHC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 105.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|