C29H27N3O5 — CID 166938873
N-benzyl-2-(N-[hydroxy(phenyl)methyl]-4-methoxyanilino)-2-(3-nitrophenyl)acetamide (PubChem CID 166938873) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is N-benzyl-2-(N-[hydroxy(phenyl)methyl]-4-methoxyanilino)-2-(3-nitrophenyl)acetamide.
| Compound Name | N-benzyl-2-(N-[hydroxy(phenyl)methyl]-4-methoxyanilino)-2-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 166938873 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-benzyl-2-(N-[hydroxy(phenyl)methyl]-4-methoxyanilino)-2-(3-nitrophenyl)acetamide |
| SMILES | COc1ccc(N(C(O)c2ccccc2)C(C(=O)NCc2ccccc2)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C29H27N3O5/c1-37-26-17-15-24(16-18-26)31(29(34)22-11-6-3-7-12-22)27(23-13-8-14-25(19-23)32(35)36)28(33)30-20-21-9-4-2-5-10-21/h2-19,27,29,34H,20H2,1H3,(H,30,33) |
| InChIKey | LXFVNPADLCMUGQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|