C30H30N2O3 — CID 102091035
(2R,3S)-N-benzyl-3-(N-benzyl-4-methoxyanilino)-2-hydroxy-3-phenylpropanamide (PubChem CID 102091035) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is (2R,3S)-N-benzyl-3-(N-benzyl-4-methoxyanilino)-2-hydroxy-3-phenylpropanamide.
| Compound Name | (2R,3S)-N-benzyl-3-(N-benzyl-4-methoxyanilino)-2-hydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 102091035 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | (2R,3S)-N-benzyl-3-(N-benzyl-4-methoxyanilino)-2-hydroxy-3-phenylpropanamide |
| SMILES | COc1ccc(N(Cc2ccccc2)[C@@H](c2ccccc2)[C@@H](O)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N2O3/c1-35-27-19-17-26(18-20-27)32(22-24-13-7-3-8-14-24)28(25-15-9-4-10-16-25)29(33)30(34)31-21-23-11-5-2-6-12-23/h2-20,28-29,33H,21-22H2,1H3,(H,31,34)/t28-,29+/m0/s1 |
| InChIKey | ZXBZOEURFFKLCZ-URLMMPGGSA-N |
| XLogP | 5.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|