C15H11N3OS — CID 141207267
2-(furan-2-yl)-4-(1H-pyrrol-2-yl)-5-thiophen-2-yl-1H-imidazole (PubChem CID 141207267) has the molecular formula C15H11N3OS and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-(furan-2-yl)-4-(1H-pyrrol-2-yl)-5-thiophen-2-yl-1H-imidazole.
| Compound Name | 2-(furan-2-yl)-4-(1H-pyrrol-2-yl)-5-thiophen-2-yl-1H-imidazole |
|---|---|
| PubChem CID | 141207267 |
| Molecular Formula | C15H11N3OS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-(furan-2-yl)-4-(1H-pyrrol-2-yl)-5-thiophen-2-yl-1H-imidazole |
| SMILES | c1c[nH]c(-c2nc(-c3ccco3)[nH]c2-c2cccs2)c1 |
| InChI | InChI=1S/C15H11N3OS/c1-4-10(16-7-1)13-14(12-6-3-9-20-12)18-15(17-13)11-5-2-8-19-11/h1-9,16H,(H,17,18) |
| InChIKey | JBVHYVWPMWCDTC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |