C14H12N4OS2 — CID 3144336
N-(furan-2-ylmethyl)-4-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,3-thiazol-2-amine (PubChem CID 3144336) has the molecular formula C14H12N4OS2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(furan-2-ylmethyl)-4-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3144336 |
| Molecular Formula | C14H12N4OS2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1nc2sccn2c1-c1csc(NCc2ccco2)n1 |
| InChI | InChI=1S/C14H12N4OS2/c1-9-12(18-4-6-20-14(18)16-9)11-8-21-13(17-11)15-7-10-3-2-5-19-10/h2-6,8H,7H2,1H3,(H,15,17) |
| InChIKey | QIAAFPUTBZMCGT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazole_amine_F(2)', 'substructure': 'N/A'} |
|---|