C13H17N7 — CID 141207496
4-[4-(azidomethyl)piperidin-1-yl]-5-methyl-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 141207496) has the molecular formula C13H17N7 and a molecular weight of 271.33 g/mol. Its IUPAC name is 4-[4-(azidomethyl)piperidin-1-yl]-5-methyl-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-[4-(azidomethyl)piperidin-1-yl]-5-methyl-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 141207496 |
| Molecular Formula | C13H17N7 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 4-[4-(azidomethyl)piperidin-1-yl]-5-methyl-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1c[nH]c2ncnc(N3CCC(CN=[N+]=[N-])CC3)c12 |
| InChI | InChI=1S/C13H17N7/c1-9-6-15-12-11(9)13(17-8-16-12)20-4-2-10(3-5-20)7-18-19-14/h6,8,10H,2-5,7H2,1H3,(H,15,16,17) |
| InChIKey | PMWJLXQNPYNOMG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|