C9H9N3O2S — CID 141207543
4-methyl-2-methylsulfinyl-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 141207543) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is 4-methyl-2-methylsulfinyl-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-methyl-2-methylsulfinyl-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 141207543 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 4-methyl-2-methylsulfinyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1nc(S(C)=O)nc2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C9H9N3O2S/c1-5-6-3-4-7(13)11-8(6)12-9(10-5)15(2)14/h3-4H,1-2H3,(H,10,11,12,13) |
| InChIKey | QNIVHJTYOSOZMT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |