C24H48ClNO3 — CID 141208202
2-hydroxypropyl-dimethyl-[[(Z)-octadec-9-enoyl]oxymethyl]azanium chloride (PubChem CID 141208202) has the molecular formula C24H48ClNO3 and a molecular weight of 434.11 g/mol. Its IUPAC name is 2-hydroxypropyl-dimethyl-[[(Z)-octadec-9-enoyl]oxymethyl]azanium chloride.
| Compound Name | 2-hydroxypropyl-dimethyl-[[(Z)-octadec-9-enoyl]oxymethyl]azanium chloride |
|---|---|
| PubChem CID | 141208202 |
| Molecular Formula | C24H48ClNO3 |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | 2-hydroxypropyl-dimethyl-[[(Z)-octadec-9-enoyl]oxymethyl]azanium chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[N+](C)(C)CC(C)O.[Cl-] |
| InChI | InChI=1S/C24H48NO3.ClH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(27)28-22-25(3,4)21-23(2)26;/h12-13,23,26H,5-11,14-22H2,1-4H3;1H/q+1;/p-1/b13-12-; |
| InChIKey | NSDPEBNMCOFKKG-USGGBSEESA-M |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|