C8H14N2O — CID 141208858
1-methyl-3,7-diazabicyclo[3.3.1]nonan-9-one (PubChem CID 141208858) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-methyl-3,7-diazabicyclo[3.3.1]nonan-9-one.
| Compound Name | 1-methyl-3,7-diazabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 141208858 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-methyl-3,7-diazabicyclo[3.3.1]nonan-9-one |
| SMILES | CC12CNCC(CNC1)C2=O |
| InChI | InChI=1S/C8H14N2O/c1-8-4-9-2-6(7(8)11)3-10-5-8/h6,9-10H,2-5H2,1H3 |
| InChIKey | RDHRFKGDLGQMNO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |