C11H14N4O2 — CID 141209381
6-(oxan-4-yloxy)imidazo[1,2-b]pyridazin-2-amine (PubChem CID 141209381) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 6-(oxan-4-yloxy)imidazo[1,2-b]pyridazin-2-amine.
| Compound Name | 6-(oxan-4-yloxy)imidazo[1,2-b]pyridazin-2-amine |
|---|---|
| PubChem CID | 141209381 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 6-(oxan-4-yloxy)imidazo[1,2-b]pyridazin-2-amine |
| SMILES | Nc1cn2nc(OC3CCOCC3)ccc2n1 |
| InChI | InChI=1S/C11H14N4O2/c12-9-7-15-10(13-9)1-2-11(14-15)17-8-3-5-16-6-4-8/h1-2,7-8H,3-6,12H2 |
| InChIKey | IKUJIMIJZYCESJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |