C7H11Br2NO — CID 141210371
(4S)-4-(2,2-dibromoethenyl)-2,2-dimethyl-1,3-oxazolidine (PubChem CID 141210371) has the molecular formula C7H11Br2NO and a molecular weight of 284.98 g/mol. Its IUPAC name is (4S)-4-(2,2-dibromoethenyl)-2,2-dimethyl-1,3-oxazolidine.
| Compound Name | (4S)-4-(2,2-dibromoethenyl)-2,2-dimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 141210371 |
| Molecular Formula | C7H11Br2NO |
| Molecular Weight | 284.98 g/mol |
| Exact Mass | 282.92 |
| IUPAC Name | (4S)-4-(2,2-dibromoethenyl)-2,2-dimethyl-1,3-oxazolidine |
| SMILES | CC1(C)N[C@@H](C=C(Br)Br)CO1 |
| InChI | InChI=1S/C7H11Br2NO/c1-7(2)10-5(4-11-7)3-6(8)9/h3,5,10H,4H2,1-2H3/t5-/m0/s1 |
| InChIKey | QUWXCUPOXAQALU-YFKPBYRVSA-N |
| XLogP | 2.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.98 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |