About 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine
4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine (PubChem CID 11174047) has the molecular formula C8H13Br2NO
and a molecular weight of 299.01 g/mol. Its IUPAC name is 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine.
Analyze 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine?
The IUPAC name of 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine (CID 11174047) is 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine.
What is the SMILES notation for 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine?
The canonical SMILES for 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine is CN1C(C=C(Br)Br)COC1(C)C.
What is the InChIKey of 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine?
The InChIKey is WMNWUKKFSTVRSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Br2NO/c1-8(2)11(3)6(5-12-8)4-7(9)10/h4,6H,5H2,1-3H3.
What are the key properties of 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine?
4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine has a molecular weight of 299.01 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dibromoethenyl)-2,2,3-trimethyl-1,3-oxazolidine is sourced from PubChem (CID 11174047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).