C22H29NO7 — CID 141212997
(10aR)-3,4-dihydroxy-10a-[4-(phenylmethoxymethyl)cyclohexyl]-4,8,9,10-tetrahydro-3H-pyrrolo[1,2-b][1,4,2]dioxazocine-2,5-dione (PubChem CID 141212997) has the molecular formula C22H29NO7 and a molecular weight of 419.47 g/mol. Its IUPAC name is (10aR)-3,4-dihydroxy-10a-[4-(phenylmethoxymethyl)cyclohexyl]-4,8,9,10-tetrahydro-3H-pyrrolo[1,2-b][1,4,2]dioxazocine-2,5-dione.
| Compound Name | (10aR)-3,4-dihydroxy-10a-[4-(phenylmethoxymethyl)cyclohexyl]-4,8,9,10-tetrahydro-3H-pyrrolo[1,2-b][1,4,2]dioxazocine-2,5-dione |
|---|---|
| PubChem CID | 141212997 |
| Molecular Formula | C22H29NO7 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (10aR)-3,4-dihydroxy-10a-[4-(phenylmethoxymethyl)cyclohexyl]-4,8,9,10-tetrahydro-3H-pyrrolo[1,2-b][1,4,2]dioxazocine-2,5-dione |
| SMILES | O=C1ON2CCC[C@]2(C2CCC(COCc3ccccc3)CC2)OC(=O)C(O)C1O |
| InChI | InChI=1S/C22H29NO7/c24-18-19(25)21(27)30-23-12-4-11-22(23,29-20(18)26)17-9-7-16(8-10-17)14-28-13-15-5-2-1-3-6-15/h1-3,5-6,16-19,24-25H,4,7-14H2/t16?,17?,18?,19?,22-/m1/s1 |
| InChIKey | XWVINRFRKSAZAU-HCKJTYGLSA-N |
| XLogP | 1.54 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |