C16H26N2O2 — CID 141216701
2-[[(5S,7S)-3-hydroxy-1-adamantyl]amino]-1-pyrrolidin-1-ylethanone (PubChem CID 141216701) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[[(5S,7S)-3-hydroxy-1-adamantyl]amino]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[[(5S,7S)-3-hydroxy-1-adamantyl]amino]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 141216701 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-[[(5S,7S)-3-hydroxy-1-adamantyl]amino]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CNC12C[C@@H]3C[C@H](CC(O)(C3)C1)C2)N1CCCC1 |
| InChI | InChI=1S/C16H26N2O2/c19-14(18-3-1-2-4-18)10-17-15-6-12-5-13(7-15)9-16(20,8-12)11-15/h12-13,17,20H,1-11H2/t12-,13-,15?,16?/m0/s1 |
| InChIKey | LTYHKNLLAPJCGH-VRLRAXNCSA-N |
| XLogP | 1.28 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |