C22H27NO3S — CID 141216994
4-[[4-(4-propan-2-ylsulfanylphenyl)phenoxy]methyl]piperidine-1-carboxylic acid (PubChem CID 141216994) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is 4-[[4-(4-propan-2-ylsulfanylphenyl)phenoxy]methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[[4-(4-propan-2-ylsulfanylphenyl)phenoxy]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141216994 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 4-[[4-(4-propan-2-ylsulfanylphenyl)phenoxy]methyl]piperidine-1-carboxylic acid |
| SMILES | CC(C)Sc1ccc(-c2ccc(OCC3CCN(C(=O)O)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H27NO3S/c1-16(2)27-21-9-5-19(6-10-21)18-3-7-20(8-4-18)26-15-17-11-13-23(14-12-17)22(24)25/h3-10,16-17H,11-15H2,1-2H3,(H,24,25) |
| InChIKey | IUVGNLXJPHVQIX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |