C24H33N2O6S+ — CID 143689729
CID 143689729 (PubChem CID 143689729) has the molecular formula C24H33N2O6S+ and a molecular weight of 477.60 g/mol.
| Compound Name | CID 143689729 |
|---|---|
| PubChem CID | 143689729 |
| Molecular Formula | C24H33N2O6S+ |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | — |
| SMILES | CC(C)OC(=O)N1CCC(COc2ccc(-c3ccc([S+](=O)(O)NCCO)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H32N2O6S/c1-18(2)32-24(28)26-14-11-19(12-15-26)17-31-22-7-3-20(4-8-22)21-5-9-23(10-6-21)33(29,30)25-13-16-27/h3-10,18-19,27H,11-17H2,1-2H3,(H-,25,29,30)/p+1 |
| InChIKey | VIAPAFUTYYZIDX-UHFFFAOYSA-O |
| XLogP | 3.82 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|