About (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one
(5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one (PubChem CID 141217209) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one |
| PubChem CID | 141217209 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc2nccc(CCCCC[C@@H]3CNC(=O)O3)c2n1 |
| InChI | InChI=1S/C17H21N3O3/c1-22-15-8-7-14-16(20-15)12(9-10-18-14)5-3-2-4-6-13-11-19-17(21)23-13/h7-10,13H,2-6,11H2,1H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | KIQYUMJXDVVUGX-CYBMUJFWSA-N |
| XLogP | 2.85 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one?
The IUPAC name of (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one (CID 141217209) is (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one?
The canonical SMILES for (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one is COc1ccc2nccc(CCCCC[C@@H]3CNC(=O)O3)c2n1.
What is the InChIKey of (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one?
The InChIKey is KIQYUMJXDVVUGX-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-22-15-8-7-14-16(20-15)12(9-10-18-14)5-3-2-4-6-13-11-19-17(21)23-13/h7-10,13H,2-6,11H2,1H3,(H,19,21)/t13-/m1/s1.
What are the key properties of (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one?
(5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one has a molecular weight of 315.37 g/mol, XLogP of 2.85, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[5-(6-methoxy-1,5-naphthyridin-4-yl)pentyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 141217209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).