C14H18O6S3 — CID 141217392
1,1,5-tris(prop-2-ynylsulfonyl)pentane (PubChem CID 141217392) has the molecular formula C14H18O6S3 and a molecular weight of 378.49 g/mol. Its IUPAC name is 1,1,5-tris(prop-2-ynylsulfonyl)pentane.
| Compound Name | 1,1,5-tris(prop-2-ynylsulfonyl)pentane |
|---|---|
| PubChem CID | 141217392 |
| Molecular Formula | C14H18O6S3 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 1,1,5-tris(prop-2-ynylsulfonyl)pentane |
| SMILES | C#CCS(=O)(=O)CCCCC(S(=O)(=O)CC#C)S(=O)(=O)CC#C |
| InChI | InChI=1S/C14H18O6S3/c1-4-10-21(15,16)13-8-7-9-14(22(17,18)11-5-2)23(19,20)12-6-3/h1-3,14H,7-13H2 |
| InChIKey | YKNPBJJYQANSQG-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|