C15H26N2O5 — CID 141217799
(2S)-9-amino-2-(cyclopentyloxycarbonylamino)-9-oxononanoic acid (PubChem CID 141217799) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2S)-9-amino-2-(cyclopentyloxycarbonylamino)-9-oxononanoic acid.
| Compound Name | (2S)-9-amino-2-(cyclopentyloxycarbonylamino)-9-oxononanoic acid |
|---|---|
| PubChem CID | 141217799 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | (2S)-9-amino-2-(cyclopentyloxycarbonylamino)-9-oxononanoic acid |
| SMILES | NC(=O)CCCCCC[C@H](NC(=O)OC1CCCC1)C(=O)O |
| InChI | InChI=1S/C15H26N2O5/c16-13(18)10-4-2-1-3-9-12(14(19)20)17-15(21)22-11-7-5-6-8-11/h11-12H,1-10H2,(H2,16,18)(H,17,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | CUICWGFGAQFEFK-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|