C8H11F2NO — CID 141220741
6-(difluoromethyl)-1,2-dimethyl-2H-pyridin-3-ol (PubChem CID 141220741) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is 6-(difluoromethyl)-1,2-dimethyl-2H-pyridin-3-ol.
| Compound Name | 6-(difluoromethyl)-1,2-dimethyl-2H-pyridin-3-ol |
|---|---|
| PubChem CID | 141220741 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 6-(difluoromethyl)-1,2-dimethyl-2H-pyridin-3-ol |
| SMILES | CC1C(O)=CC=C(C(F)F)N1C |
| InChI | InChI=1S/C8H11F2NO/c1-5-7(12)4-3-6(8(9)10)11(5)2/h3-5,8,12H,1-2H3 |
| InChIKey | YPGPVWAQABTZSO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |