C9H12F3NO — CID 141220747
1,2-dimethyl-6-(2,2,2-trifluoroethyl)-2H-pyridin-3-ol (PubChem CID 141220747) has the molecular formula C9H12F3NO and a molecular weight of 207.19 g/mol. Its IUPAC name is 1,2-dimethyl-6-(2,2,2-trifluoroethyl)-2H-pyridin-3-ol.
| Compound Name | 1,2-dimethyl-6-(2,2,2-trifluoroethyl)-2H-pyridin-3-ol |
|---|---|
| PubChem CID | 141220747 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1,2-dimethyl-6-(2,2,2-trifluoroethyl)-2H-pyridin-3-ol |
| SMILES | CC1C(O)=CC=C(CC(F)(F)F)N1C |
| InChI | InChI=1S/C9H12F3NO/c1-6-8(14)4-3-7(13(6)2)5-9(10,11)12/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | NDEPELCOPAGSHI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |