C17H20FNO3 — CID 141221379
(1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-6,9-dihydroxy-3-azatricyclo[6.2.1.02,7]undecan-4-one (PubChem CID 141221379) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is (1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-6,9-dihydroxy-3-azatricyclo[6.2.1.02,7]undecan-4-one.
| Compound Name | (1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-6,9-dihydroxy-3-azatricyclo[6.2.1.02,7]undecan-4-one |
|---|---|
| PubChem CID | 141221379 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (1R,2S,7R,8S)-3-[(4-fluorophenyl)methyl]-6,9-dihydroxy-3-azatricyclo[6.2.1.02,7]undecan-4-one |
| SMILES | O=C1CC(O)[C@H]2[C@H]([C@H]3CC(O)[C@H]2C3)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FNO3/c18-11-3-1-9(2-4-11)8-19-15(22)7-14(21)16-12-5-10(17(16)19)6-13(12)20/h1-4,10,12-14,16-17,20-21H,5-8H2/t10-,12-,13?,14?,16+,17+/m1/s1 |
| InChIKey | BUDFZHXIEOQTNF-HOJAKZHVSA-N |
| XLogP | 1.30 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |