C17H19F2NO2 — CID 141221368
(1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-6-hydroxy-3-azatricyclo[6.2.1.02,7]undecan-4-one (PubChem CID 141221368) has the molecular formula C17H19F2NO2 and a molecular weight of 307.34 g/mol. Its IUPAC name is (1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-6-hydroxy-3-azatricyclo[6.2.1.02,7]undecan-4-one.
| Compound Name | (1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-6-hydroxy-3-azatricyclo[6.2.1.02,7]undecan-4-one |
|---|---|
| PubChem CID | 141221368 |
| Molecular Formula | C17H19F2NO2 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (1R,2S,7R,8S)-3-[(3,4-difluorophenyl)methyl]-6-hydroxy-3-azatricyclo[6.2.1.02,7]undecan-4-one |
| SMILES | O=C1CC(O)[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2N1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H19F2NO2/c18-12-4-1-9(5-13(12)19)8-20-15(22)7-14(21)16-10-2-3-11(6-10)17(16)20/h1,4-5,10-11,14,16-17,21H,2-3,6-8H2/t10-,11+,14?,16-,17-/m0/s1 |
| InChIKey | UXOFOMOKMSJFJI-MZBQPCNASA-N |
| XLogP | 2.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |