C22H26FNO4 — CID 123482539
ethyl 2-ethyl-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecane-5-carboxylate (PubChem CID 123482539) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is ethyl 2-ethyl-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecane-5-carboxylate.
| Compound Name | ethyl 2-ethyl-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecane-5-carboxylate |
|---|---|
| PubChem CID | 123482539 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | ethyl 2-ethyl-3-[(4-fluorophenyl)methyl]-4,6-dioxo-3-azatricyclo[6.2.1.02,7]undecane-5-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C2C3CCC(C3)C2(CC)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C22H26FNO4/c1-3-22-15-8-7-14(11-15)18(22)19(25)17(21(27)28-4-2)20(26)24(22)12-13-5-9-16(23)10-6-13/h5-6,9-10,14-15,17-18H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | LMXACLFEQYCBGN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|