C22H28FNO5 — CID 71048012
ethyl (1S,2R,3S,4R)-3-[(3-ethoxy-3-oxopropanoyl)-[(4-fluorophenyl)methyl]amino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 71048012) has the molecular formula C22H28FNO5 and a molecular weight of 405.47 g/mol. Its IUPAC name is ethyl (1S,2R,3S,4R)-3-[(3-ethoxy-3-oxopropanoyl)-[(4-fluorophenyl)methyl]amino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (1S,2R,3S,4R)-3-[(3-ethoxy-3-oxopropanoyl)-[(4-fluorophenyl)methyl]amino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 71048012 |
| Molecular Formula | C22H28FNO5 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | ethyl (1S,2R,3S,4R)-3-[(3-ethoxy-3-oxopropanoyl)-[(4-fluorophenyl)methyl]amino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)CC(=O)N(Cc1ccc(F)cc1)[C@H]1[C@@H]2CC[C@@H](C2)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C22H28FNO5/c1-3-28-19(26)12-18(25)24(13-14-5-9-17(23)10-6-14)21-16-8-7-15(11-16)20(21)22(27)29-4-2/h5-6,9-10,15-16,20-21H,3-4,7-8,11-13H2,1-2H3/t15-,16+,20+,21-/m0/s1 |
| InChIKey | XYWBYHSRKCEGBG-HDIOYNLWSA-N |
| XLogP | 3.09 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|