C20H22FNO4 — CID 58000224
ethyl (1S,8R)-3-[(4-fluorophenyl)methyl]-6-hydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-ene-5-carboxylate (PubChem CID 58000224) has the molecular formula C20H22FNO4 and a molecular weight of 359.40 g/mol. Its IUPAC name is ethyl (1S,8R)-3-[(4-fluorophenyl)methyl]-6-hydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-ene-5-carboxylate.
| Compound Name | ethyl (1S,8R)-3-[(4-fluorophenyl)methyl]-6-hydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-ene-5-carboxylate |
|---|---|
| PubChem CID | 58000224 |
| Molecular Formula | C20H22FNO4 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | ethyl (1S,8R)-3-[(4-fluorophenyl)methyl]-6-hydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-ene-5-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C2C([C@H]3CC[C@@H]2C3)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H22FNO4/c1-2-26-20(25)16-18(23)15-12-5-6-13(9-12)17(15)22(19(16)24)10-11-3-7-14(21)8-4-11/h3-4,7-8,12-13,15,17,23H,2,5-6,9-10H2,1H3/t12-,13+,15?,17?/m1/s1 |
| InChIKey | QXZJQARTZDBKEZ-HGDLATOJSA-N |
| XLogP | 2.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|